C22H28ClFN2O5S2 — CID 30266645
N-(2-tert-butylsulfanylethyl)-2-(3-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)acetamide (PubChem CID 30266645) has the molecular formula C22H28ClFN2O5S2 and a molecular weight of 519.06 g/mol. Its IUPAC name is N-(2-tert-butylsulfanylethyl)-2-(3-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)acetamide.
| Compound Name | N-(2-tert-butylsulfanylethyl)-2-(3-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)acetamide |
|---|---|
| PubChem CID | 30266645 |
| Molecular Formula | C22H28ClFN2O5S2 |
| Molecular Weight | 519.06 g/mol |
| Exact Mass | 518.11 |
| IUPAC Name | N-(2-tert-butylsulfanylethyl)-2-(3-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)NCCSC(C)(C)C)c2ccc(F)c(Cl)c2)cc1OC |
| InChI | InChI=1S/C22H28ClFN2O5S2/c1-22(2,3)32-11-10-25-21(27)14-26(15-6-8-18(24)17(23)12-15)33(28,29)16-7-9-19(30-4)20(13-16)31-5/h6-9,12-13H,10-11,14H2,1-5H3,(H,25,27) |
| InChIKey | JAOUTWXFPVUSSU-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.06 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|