C27H29ClFN3O6S — CID 43900215
2-(3-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)-N-[(4-morpholin-4-ylphenyl)methyl]acetamide (PubChem CID 43900215) has the molecular formula C27H29ClFN3O6S and a molecular weight of 578.06 g/mol. Its IUPAC name is 2-(3-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)-N-[(4-morpholin-4-ylphenyl)methyl]acetamide.
| Compound Name | 2-(3-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)-N-[(4-morpholin-4-ylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 43900215 |
| Molecular Formula | C27H29ClFN3O6S |
| Molecular Weight | 578.06 g/mol |
| Exact Mass | 577.14 |
| IUPAC Name | 2-(3-chloro-N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)-N-[(4-morpholin-4-ylphenyl)methyl]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)NCc2ccc(N3CCOCC3)cc2)c2ccc(F)c(Cl)c2)cc1OC |
| InChI | InChI=1S/C27H29ClFN3O6S/c1-36-25-10-8-22(16-26(25)37-2)39(34,35)32(21-7-9-24(29)23(28)15-21)18-27(33)30-17-19-3-5-20(6-4-19)31-11-13-38-14-12-31/h3-10,15-16H,11-14,17-18H2,1-2H3,(H,30,33) |
| InChIKey | IXAPFNASTRPCNV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.06 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|