C22H21BrN2O3S2 — CID 51343326
2-[N-(benzenesulfonyl)-3-bromoanilino]-N-(2-phenylsulfanylethyl)acetamide (PubChem CID 51343326) has the molecular formula C22H21BrN2O3S2 and a molecular weight of 505.46 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3-bromoanilino]-N-(2-phenylsulfanylethyl)acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3-bromoanilino]-N-(2-phenylsulfanylethyl)acetamide |
|---|---|
| PubChem CID | 51343326 |
| Molecular Formula | C22H21BrN2O3S2 |
| Molecular Weight | 505.46 g/mol |
| Exact Mass | 504.02 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3-bromoanilino]-N-(2-phenylsulfanylethyl)acetamide |
| SMILES | O=C(CN(c1cccc(Br)c1)S(=O)(=O)c1ccccc1)NCCSc1ccccc1 |
| InChI | InChI=1S/C22H21BrN2O3S2/c23-18-8-7-9-19(16-18)25(30(27,28)21-12-5-2-6-13-21)17-22(26)24-14-15-29-20-10-3-1-4-11-20/h1-13,16H,14-15,17H2,(H,24,26) |
| InChIKey | NSIMXCNBHAXJGM-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.46 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|