C26H36N2O5S2 — CID 30227803
N-(3-cyclohexyloxypropyl)-2-(4-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide (PubChem CID 30227803) has the molecular formula C26H36N2O5S2 and a molecular weight of 520.72 g/mol. Its IUPAC name is N-(3-cyclohexyloxypropyl)-2-(4-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide.
| Compound Name | N-(3-cyclohexyloxypropyl)-2-(4-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 30227803 |
| Molecular Formula | C26H36N2O5S2 |
| Molecular Weight | 520.72 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | N-(3-cyclohexyloxypropyl)-2-(4-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide |
| SMILES | CCOc1ccc(N(CC(=O)NCCCOC2CCCCC2)S(=O)(=O)c2ccc(SC)cc2)cc1 |
| InChI | InChI=1S/C26H36N2O5S2/c1-3-32-23-12-10-21(11-13-23)28(35(30,31)25-16-14-24(34-2)15-17-25)20-26(29)27-18-7-19-33-22-8-5-4-6-9-22/h10-17,22H,3-9,18-20H2,1-2H3,(H,27,29) |
| InChIKey | TUDZHMPLWWDMPZ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.72 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|