C23H30N2O5S2 — CID 4656031
2-(4-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)-N-(2-hydroxycyclohexyl)acetamide (PubChem CID 4656031) has the molecular formula C23H30N2O5S2 and a molecular weight of 478.64 g/mol. Its IUPAC name is 2-(4-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)-N-(2-hydroxycyclohexyl)acetamide.
| Compound Name | 2-(4-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)-N-(2-hydroxycyclohexyl)acetamide |
|---|---|
| PubChem CID | 4656031 |
| Molecular Formula | C23H30N2O5S2 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | 2-(4-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)-N-(2-hydroxycyclohexyl)acetamide |
| SMILES | CCOc1ccc(N(CC(=O)NC2CCCCC2O)S(=O)(=O)c2ccc(SC)cc2)cc1 |
| InChI | InChI=1S/C23H30N2O5S2/c1-3-30-18-10-8-17(9-11-18)25(16-23(27)24-21-6-4-5-7-22(21)26)32(28,29)20-14-12-19(31-2)13-15-20/h8-15,21-22,26H,3-7,16H2,1-2H3,(H,24,27) |
| InChIKey | UYZGIAJGLJQTJZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |