C27H31ClN2O4S3 — CID 43898922
N-[3-[(3-chlorophenyl)methylsulfanyl]propyl]-2-(2-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide (PubChem CID 43898922) has the molecular formula C27H31ClN2O4S3 and a molecular weight of 579.21 g/mol. Its IUPAC name is N-[3-[(3-chlorophenyl)methylsulfanyl]propyl]-2-(2-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide.
| Compound Name | N-[3-[(3-chlorophenyl)methylsulfanyl]propyl]-2-(2-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 43898922 |
| Molecular Formula | C27H31ClN2O4S3 |
| Molecular Weight | 579.21 g/mol |
| Exact Mass | 578.11 |
| IUPAC Name | N-[3-[(3-chlorophenyl)methylsulfanyl]propyl]-2-(2-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetamide |
| SMILES | CCOc1ccccc1N(CC(=O)NCCCSCc1cccc(Cl)c1)S(=O)(=O)c1ccc(SC)cc1 |
| InChI | InChI=1S/C27H31ClN2O4S3/c1-3-34-26-11-5-4-10-25(26)30(37(32,33)24-14-12-23(35-2)13-15-24)19-27(31)29-16-7-17-36-20-21-8-6-9-22(28)18-21/h4-6,8-15,18H,3,7,16-17,19-20H2,1-2H3,(H,29,31) |
| InChIKey | JVDVRZVNVOVZTA-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.21 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|