C20H24FN3O5S2 — CID 30254605
N-[3-[(4-fluorophenyl)methylsulfanyl]propyl]-2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetamide (PubChem CID 30254605) has the molecular formula C20H24FN3O5S2 and a molecular weight of 469.56 g/mol. Its IUPAC name is N-[3-[(4-fluorophenyl)methylsulfanyl]propyl]-2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetamide.
| Compound Name | N-[3-[(4-fluorophenyl)methylsulfanyl]propyl]-2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetamide |
|---|---|
| PubChem CID | 30254605 |
| Molecular Formula | C20H24FN3O5S2 |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | N-[3-[(4-fluorophenyl)methylsulfanyl]propyl]-2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1N(CC(=O)NCCCSCc1ccc(F)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C20H24FN3O5S2/c1-15-4-9-18(24(26)27)12-19(15)23(31(2,28)29)13-20(25)22-10-3-11-30-14-16-5-7-17(21)8-6-16/h4-9,12H,3,10-11,13-14H2,1-2H3,(H,22,25) |
| InChIKey | PYLUSQCPFDYWIO-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|