C25H24N2O3 — CID 1277512
1-N-[[(2S)-oxolan-2-yl]methyl]-2-N,2-N-diphenylbenzene-1,2-dicarboxamide (PubChem CID 1277512) has the molecular formula C25H24N2O3 and a molecular weight of 400.48 g/mol. Its IUPAC name is 1-N-[[(2S)-oxolan-2-yl]methyl]-2-N,2-N-diphenylbenzene-1,2-dicarboxamide.
| Compound Name | 1-N-[[(2S)-oxolan-2-yl]methyl]-2-N,2-N-diphenylbenzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 1277512 |
| Molecular Formula | C25H24N2O3 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 1-N-[[(2S)-oxolan-2-yl]methyl]-2-N,2-N-diphenylbenzene-1,2-dicarboxamide |
| SMILES | O=C(NC[C@@H]1CCCO1)c1ccccc1C(=O)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H24N2O3/c28-24(26-18-21-14-9-17-30-21)22-15-7-8-16-23(22)25(29)27(19-10-3-1-4-11-19)20-12-5-2-6-13-20/h1-8,10-13,15-16,21H,9,14,17-18H2,(H,26,28)/t21-/m0/s1 |
| InChIKey | OSBGASJVUORLSJ-NRFANRHFSA-N |
| XLogP | 4.57 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |