C18H25N4O2+ — CID 8546860
(3R)-1-[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl]piperidin-1-ium-3-carboxamide (PubChem CID 8546860) has the molecular formula C18H25N4O2+ and a molecular weight of 329.42 g/mol. Its IUPAC name is (3R)-1-[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl]piperidin-1-ium-3-carboxamide.
| Compound Name | (3R)-1-[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl]piperidin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 8546860 |
| Molecular Formula | C18H25N4O2+ |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | (3R)-1-[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl]piperidin-1-ium-3-carboxamide |
| SMILES | NC(=O)[C@@H]1CCC[NH+](CC(=O)NCCc2c[nH]c3ccccc23)C1 |
| InChI | InChI=1S/C18H24N4O2/c19-18(24)14-4-3-9-22(11-14)12-17(23)20-8-7-13-10-21-16-6-2-1-5-15(13)16/h1-2,5-6,10,14,21H,3-4,7-9,11-12H2,(H2,19,24)(H,20,23)/p+1/t14-/m1/s1 |
| InChIKey | JNQOVBOKMQSYOP-CQSZACIVSA-O |
| XLogP | -0.39 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |