C19H27N4O3+ — CID 8545802
ethyl 4-[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl]piperazin-4-ium-1-carboxylate (PubChem CID 8545802) has the molecular formula C19H27N4O3+ and a molecular weight of 359.45 g/mol. Its IUPAC name is ethyl 4-[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl]piperazin-4-ium-1-carboxylate.
| Compound Name | ethyl 4-[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl]piperazin-4-ium-1-carboxylate |
|---|---|
| PubChem CID | 8545802 |
| Molecular Formula | C19H27N4O3+ |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | ethyl 4-[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl]piperazin-4-ium-1-carboxylate |
| SMILES | CCOC(=O)N1CC[NH+](CC(=O)NCCc2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C19H26N4O3/c1-2-26-19(25)23-11-9-22(10-12-23)14-18(24)20-8-7-15-13-21-17-6-4-3-5-16(15)17/h3-6,13,21H,2,7-12,14H2,1H3,(H,20,24)/p+1 |
| InChIKey | DZFHZDFHCIBWJZ-UHFFFAOYSA-O |
| XLogP | 0.18 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |