C24H29FN4O2 — CID 86875671
1-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-3-[2-(6-methyl-1H-indol-3-yl)ethyl]urea (PubChem CID 86875671) has the molecular formula C24H29FN4O2 and a molecular weight of 424.52 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-3-[2-(6-methyl-1H-indol-3-yl)ethyl]urea.
| Compound Name | 1-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-3-[2-(6-methyl-1H-indol-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 86875671 |
| Molecular Formula | C24H29FN4O2 |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | 1-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-3-[2-(6-methyl-1H-indol-3-yl)ethyl]urea |
| SMILES | Cc1ccc2c(CCNC(=O)NCC(c3ccc(F)cc3)N3CCOCC3)c[nH]c2c1 |
| InChI | InChI=1S/C24H29FN4O2/c1-17-2-7-21-19(15-27-22(21)14-17)8-9-26-24(30)28-16-23(29-10-12-31-13-11-29)18-3-5-20(25)6-4-18/h2-7,14-15,23,27H,8-13,16H2,1H3,(H2,26,28,30) |
| InChIKey | YDAKZFHVPAXNQD-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |