C22H28N6OS — CID 111284603
1-[(2-imidazol-1-ylphenyl)methyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine (PubChem CID 111284603) has the molecular formula C22H28N6OS and a molecular weight of 424.57 g/mol. Its IUPAC name is 1-[(2-imidazol-1-ylphenyl)methyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine.
| Compound Name | 1-[(2-imidazol-1-ylphenyl)methyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111284603 |
| Molecular Formula | C22H28N6OS |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 1-[(2-imidazol-1-ylphenyl)methyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine |
| SMILES | C/N=C(/NCc1ccccc1-n1ccnc1)NCC(c1cccs1)N1CCOCC1 |
| InChI | InChI=1S/C22H28N6OS/c1-23-22(25-15-18-5-2-3-6-19(18)28-9-8-24-17-28)26-16-20(21-7-4-14-30-21)27-10-12-29-13-11-27/h2-9,14,17,20H,10-13,15-16H2,1H3,(H2,23,25,26) |
| InChIKey | KKYPIALYWVHKEX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|