C20H25F3N4O2S — CID 111283849
2-methyl-1-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-3-[[2-(trifluoromethoxy)phenyl]methyl]guanidine (PubChem CID 111283849) has the molecular formula C20H25F3N4O2S and a molecular weight of 442.51 g/mol. Its IUPAC name is 2-methyl-1-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-3-[[2-(trifluoromethoxy)phenyl]methyl]guanidine.
| Compound Name | 2-methyl-1-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-3-[[2-(trifluoromethoxy)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111283849 |
| Molecular Formula | C20H25F3N4O2S |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 2-methyl-1-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-3-[[2-(trifluoromethoxy)phenyl]methyl]guanidine |
| SMILES | C/N=C(/NCc1ccccc1OC(F)(F)F)NCC(c1cccs1)N1CCOCC1 |
| InChI | InChI=1S/C20H25F3N4O2S/c1-24-19(25-13-15-5-2-3-6-17(15)29-20(21,22)23)26-14-16(18-7-4-12-30-18)27-8-10-28-11-9-27/h2-7,12,16H,8-11,13-14H2,1H3,(H2,24,25,26) |
| InChIKey | HLWJQVJJZHCJOV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|