C19H21F3N4S — CID 111982517
1-ethyl-2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine (PubChem CID 111982517) has the molecular formula C19H21F3N4S and a molecular weight of 394.47 g/mol. Its IUPAC name is 1-ethyl-2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine.
| Compound Name | 1-ethyl-2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine |
|---|---|
| PubChem CID | 111982517 |
| Molecular Formula | C19H21F3N4S |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 1-ethyl-2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine |
| SMILES | CCN/C(=N\Cc1ncc(CC)s1)NCC#Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H21F3N4S/c1-3-16-12-25-17(27-16)13-26-18(23-4-2)24-10-6-8-14-7-5-9-15(11-14)19(20,21)22/h5,7,9,11-12H,3-4,10,13H2,1-2H3,(H2,23,24,26) |
| InChIKey | RXNOCZVFKVLEAY-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|