C19H19F6IN4S — CID 136920298
1-ethyl-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]-2-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide (PubChem CID 136920298) has the molecular formula C19H19F6IN4S and a molecular weight of 576.35 g/mol. Its IUPAC name is 1-ethyl-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]-2-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]-2-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 136920298 |
| Molecular Formula | C19H19F6IN4S |
| Molecular Weight | 576.35 g/mol |
| Exact Mass | 576.03 |
| IUPAC Name | 1-ethyl-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]-2-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1nc(C(F)(F)F)cs1)NCC#Cc1cccc(C(F)(F)F)c1.I |
| InChI | InChI=1S/C19H18F6N4S.HI/c1-2-26-17(28-10-8-16-29-15(12-30-16)19(23,24)25)27-9-4-6-13-5-3-7-14(11-13)18(20,21)22;/h3,5,7,11-12H,2,8-10H2,1H3,(H2,26,27,28);1H |
| InChIKey | CFYKCWZKYIZCRQ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.35 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|