C19H22F3IN4S — CID 136922293
1-ethyl-2-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine;hydroiodide (PubChem CID 136922293) has the molecular formula C19H22F3IN4S and a molecular weight of 522.38 g/mol. Its IUPAC name is 1-ethyl-2-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 136922293 |
| Molecular Formula | C19H22F3IN4S |
| Molecular Weight | 522.38 g/mol |
| Exact Mass | 522.06 |
| IUPAC Name | 1-ethyl-2-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1csc(C)n1)NCC#Cc1cccc(C(F)(F)F)c1.I |
| InChI | InChI=1S/C19H21F3N4S.HI/c1-3-23-18(25-11-9-17-13-27-14(2)26-17)24-10-5-7-15-6-4-8-16(12-15)19(20,21)22;/h4,6,8,12-13H,3,9-11H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | UHWTWPROICSQID-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.38 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|