C19H24F3IN6 — CID 136920300
1-ethyl-2-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine;hydroiodide (PubChem CID 136920300) has the molecular formula C19H24F3IN6 and a molecular weight of 520.34 g/mol. Its IUPAC name is 1-ethyl-2-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 136920300 |
| Molecular Formula | C19H24F3IN6 |
| Molecular Weight | 520.34 g/mol |
| Exact Mass | 520.11 |
| IUPAC Name | 1-ethyl-2-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCn1cnnc1CC)NCC#Cc1cccc(C(F)(F)F)c1.I |
| InChI | InChI=1S/C19H23F3N6.HI/c1-3-17-27-26-14-28(17)12-11-25-18(23-4-2)24-10-6-8-15-7-5-9-16(13-15)19(20,21)22;/h5,7,9,13-14H,3-4,10-12H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | AIYLDOJQBIDTHF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|