C18H24N8 — CID 111013703
2-[[2-(dimethylamino)-4-pyridinyl]methyl]-1-ethyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine (PubChem CID 111013703) has the molecular formula C18H24N8 and a molecular weight of 352.45 g/mol. Its IUPAC name is 2-[[2-(dimethylamino)-4-pyridinyl]methyl]-1-ethyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine.
| Compound Name | 2-[[2-(dimethylamino)-4-pyridinyl]methyl]-1-ethyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111013703 |
| Molecular Formula | C18H24N8 |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | 2-[[2-(dimethylamino)-4-pyridinyl]methyl]-1-ethyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccnc(N(C)C)c1)NCc1nnc2ccccn12 |
| InChI | InChI=1S/C18H24N8/c1-4-19-18(21-12-14-8-9-20-16(11-14)25(2)3)22-13-17-24-23-15-7-5-6-10-26(15)17/h5-11H,4,12-13H2,1-3H3,(H2,19,21,22) |
| InChIKey | FZPVXXKYLWBLQG-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 82.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|