C15H24N8 — CID 111708445
2-[[2-(dimethylamino)-4-pyridinyl]methyl]-1-ethyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine (PubChem CID 111708445) has the molecular formula C15H24N8 and a molecular weight of 316.41 g/mol. Its IUPAC name is 2-[[2-(dimethylamino)-4-pyridinyl]methyl]-1-ethyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine.
| Compound Name | 2-[[2-(dimethylamino)-4-pyridinyl]methyl]-1-ethyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111708445 |
| Molecular Formula | C15H24N8 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.21 |
| IUPAC Name | 2-[[2-(dimethylamino)-4-pyridinyl]methyl]-1-ethyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccnc(N(C)C)c1)NCc1ncnn1C |
| InChI | InChI=1S/C15H24N8/c1-5-16-15(19-10-14-20-11-21-23(14)4)18-9-12-6-7-17-13(8-12)22(2)3/h6-8,11H,5,9-10H2,1-4H3,(H2,16,18,19) |
| InChIKey | FIUOMICGJRDPSL-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 83.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|