C18H28N8 — CID 111707063
1-ethyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]-2-[(2-piperidin-1-yl-4-pyridinyl)methyl]guanidine (PubChem CID 111707063) has the molecular formula C18H28N8 and a molecular weight of 356.48 g/mol. Its IUPAC name is 1-ethyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]-2-[(2-piperidin-1-yl-4-pyridinyl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]-2-[(2-piperidin-1-yl-4-pyridinyl)methyl]guanidine |
|---|---|
| PubChem CID | 111707063 |
| Molecular Formula | C18H28N8 |
| Molecular Weight | 356.48 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | 1-ethyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]-2-[(2-piperidin-1-yl-4-pyridinyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccnc(N2CCCCC2)c1)NCc1ncnn1C |
| InChI | InChI=1S/C18H28N8/c1-3-19-18(22-13-17-23-14-24-25(17)2)21-12-15-7-8-20-16(11-15)26-9-5-4-6-10-26/h7-8,11,14H,3-6,9-10,12-13H2,1-2H3,(H2,19,21,22) |
| InChIKey | RIZCBLBYFXRUFP-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 83.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.48 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|