C18H26F2N6O — CID 111700203
2-[[3-(2,2-difluoroethoxy)phenyl]methyl]-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine (PubChem CID 111700203) has the molecular formula C18H26F2N6O and a molecular weight of 380.44 g/mol. Its IUPAC name is 2-[[3-(2,2-difluoroethoxy)phenyl]methyl]-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine.
| Compound Name | 2-[[3-(2,2-difluoroethoxy)phenyl]methyl]-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111700203 |
| Molecular Formula | C18H26F2N6O |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 2-[[3-(2,2-difluoroethoxy)phenyl]methyl]-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(OCC(F)F)c1)NCCn1cnnc1CC |
| InChI | InChI=1S/C18H26F2N6O/c1-3-17-25-24-13-26(17)9-8-22-18(21-4-2)23-11-14-6-5-7-15(10-14)27-12-16(19)20/h5-7,10,13,16H,3-4,8-9,11-12H2,1-2H3,(H2,21,22,23) |
| InChIKey | ZYKMXRGNEJOPAI-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|