C21H26FN7O — CID 111699209
1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]guanidine (PubChem CID 111699209) has the molecular formula C21H26FN7O and a molecular weight of 411.49 g/mol. Its IUPAC name is 1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111699209 |
| Molecular Formula | C21H26FN7O |
| Molecular Weight | 411.49 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(Oc2cccc(F)c2)nc1)NCCn1cnnc1CC |
| InChI | InChI=1S/C21H26FN7O/c1-3-19-28-27-15-29(19)11-10-24-21(23-4-2)26-14-16-8-9-20(25-13-16)30-18-7-5-6-17(22)12-18/h5-9,12-13,15H,3-4,10-11,14H2,1-2H3,(H2,23,24,26) |
| InChIKey | ORTVDEXAEOXZHZ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.49 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|