C19H33IN4O2S — CID 111611781
N-ethyl-2-[3-[[[ethylamino-[(2-methyl-2-methylsulfanylpropyl)amino]methylidene]amino]methyl]phenoxy]acetamide;hydroiodide (PubChem CID 111611781) has the molecular formula C19H33IN4O2S and a molecular weight of 508.47 g/mol. Its IUPAC name is N-ethyl-2-[3-[[[ethylamino-[(2-methyl-2-methylsulfanylpropyl)amino]methylidene]amino]methyl]phenoxy]acetamide;hydroiodide.
| Compound Name | N-ethyl-2-[3-[[[ethylamino-[(2-methyl-2-methylsulfanylpropyl)amino]methylidene]amino]methyl]phenoxy]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111611781 |
| Molecular Formula | C19H33IN4O2S |
| Molecular Weight | 508.47 g/mol |
| Exact Mass | 508.14 |
| IUPAC Name | N-ethyl-2-[3-[[[ethylamino-[(2-methyl-2-methylsulfanylpropyl)amino]methylidene]amino]methyl]phenoxy]acetamide;hydroiodide |
| SMILES | CCNC(=O)COc1cccc(C/N=C(\NCC)NCC(C)(C)SC)c1.I |
| InChI | InChI=1S/C19H32N4O2S.HI/c1-6-20-17(24)13-25-16-10-8-9-15(11-16)12-22-18(21-7-2)23-14-19(3,4)26-5;/h8-11H,6-7,12-14H2,1-5H3,(H,20,24)(H2,21,22,23);1H |
| InChIKey | VFERQPULZZKRCW-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.47 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|