C22H27IN4OS — CID 109419205
1-ethyl-3-(2-hydroxy-2-thiophen-2-ylpropyl)-2-[(3-pyridin-2-ylphenyl)methyl]guanidine;hydroiodide (PubChem CID 109419205) has the molecular formula C22H27IN4OS and a molecular weight of 522.46 g/mol. Its IUPAC name is 1-ethyl-3-(2-hydroxy-2-thiophen-2-ylpropyl)-2-[(3-pyridin-2-ylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(2-hydroxy-2-thiophen-2-ylpropyl)-2-[(3-pyridin-2-ylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109419205 |
| Molecular Formula | C22H27IN4OS |
| Molecular Weight | 522.46 g/mol |
| Exact Mass | 522.10 |
| IUPAC Name | 1-ethyl-3-(2-hydroxy-2-thiophen-2-ylpropyl)-2-[(3-pyridin-2-ylphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(-c2ccccn2)c1)NCC(C)(O)c1cccs1.I |
| InChI | InChI=1S/C22H26N4OS.HI/c1-3-23-21(26-16-22(2,27)20-11-7-13-28-20)25-15-17-8-6-9-18(14-17)19-10-4-5-12-24-19;/h4-14,27H,3,15-16H2,1-2H3,(H2,23,25,26);1H |
| InChIKey | GYBNGQLWOQKMRF-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.46 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|