C24H42N6O2 — CID 111885425
tert-butyl N-[2-[[N-ethyl-N'-[[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]methyl]carbamimidoyl]amino]ethyl]carbamate (PubChem CID 111885425) has the molecular formula C24H42N6O2 and a molecular weight of 446.64 g/mol. Its IUPAC name is tert-butyl N-[2-[[N-ethyl-N'-[[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]methyl]carbamimidoyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[N-ethyl-N'-[[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]methyl]carbamimidoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 111885425 |
| Molecular Formula | C24H42N6O2 |
| Molecular Weight | 446.64 g/mol |
| Exact Mass | 446.34 |
| IUPAC Name | tert-butyl N-[2-[[N-ethyl-N'-[[4-[(4-ethylpiperazin-1-yl)methyl]phenyl]methyl]carbamimidoyl]amino]ethyl]carbamate |
| SMILES | CCN/C(=N\Cc1ccc(CN2CCN(CC)CC2)cc1)NCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H42N6O2/c1-6-25-22(26-12-13-27-23(31)32-24(3,4)5)28-18-20-8-10-21(11-9-20)19-30-16-14-29(7-2)15-17-30/h8-11H,6-7,12-19H2,1-5H3,(H,27,31)(H2,25,26,28) |
| InChIKey | KCRKVJCCVKAYAA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 81.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.64 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|