C16H22ClIN4S — CID 111131669
2-[(4-chlorophenyl)methyl]-1-ethyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide (PubChem CID 111131669) has the molecular formula C16H22ClIN4S and a molecular weight of 464.80 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl]-1-ethyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[(4-chlorophenyl)methyl]-1-ethyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111131669 |
| Molecular Formula | C16H22ClIN4S |
| Molecular Weight | 464.80 g/mol |
| Exact Mass | 464.03 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl]-1-ethyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(Cl)cc1)NCCc1csc(C)n1.I |
| InChI | InChI=1S/C16H21ClN4S.HI/c1-3-18-16(19-9-8-15-11-22-12(2)21-15)20-10-13-4-6-14(17)7-5-13;/h4-7,11H,3,8-10H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | ZYMPGXRESFQYJJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.80 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|