C21H31N7 — CID 111245153
1-ethyl-2-[(4-methylphenyl)methyl]-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine (PubChem CID 111245153) has the molecular formula C21H31N7 and a molecular weight of 381.53 g/mol. Its IUPAC name is 1-ethyl-2-[(4-methylphenyl)methyl]-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine.
| Compound Name | 1-ethyl-2-[(4-methylphenyl)methyl]-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111245153 |
| Molecular Formula | C21H31N7 |
| Molecular Weight | 381.53 g/mol |
| Exact Mass | 381.26 |
| IUPAC Name | 1-ethyl-2-[(4-methylphenyl)methyl]-3-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(C)cc1)NCCN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C21H31N7/c1-3-22-20(26-17-19-7-5-18(2)6-8-19)23-11-12-27-13-15-28(16-14-27)21-24-9-4-10-25-21/h4-10H,3,11-17H2,1-2H3,(H2,22,23,26) |
| InChIKey | NERZFVRTQQGDLK-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.53 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|