C23H39IN6OS — CID 111666323
1-ethyl-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-3-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111666323) has the molecular formula C23H39IN6OS and a molecular weight of 574.58 g/mol. Its IUPAC name is 1-ethyl-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-3-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-3-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111666323 |
| Molecular Formula | C23H39IN6OS |
| Molecular Weight | 574.58 g/mol |
| Exact Mass | 574.20 |
| IUPAC Name | 1-ethyl-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-3-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1c(C)nn(CCOC)c1C)NCC1CCCN(C)C1c1cccs1.I |
| InChI | InChI=1S/C23H38N6OS.HI/c1-6-24-23(26-16-20-17(2)27-29(18(20)3)12-13-30-5)25-15-19-9-7-11-28(4)22(19)21-10-8-14-31-21;/h8,10,14,19,22H,6-7,9,11-13,15-16H2,1-5H3,(H2,24,25,26);1H |
| InChIKey | FSOCMYHXHREEGY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.58 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|