C18H29IN6S — CID 111666141
1-ethyl-3-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]-2-(1H-pyrazol-5-ylmethyl)guanidine;hydroiodide (PubChem CID 111666141) has the molecular formula C18H29IN6S and a molecular weight of 488.44 g/mol. Its IUPAC name is 1-ethyl-3-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]-2-(1H-pyrazol-5-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]-2-(1H-pyrazol-5-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111666141 |
| Molecular Formula | C18H29IN6S |
| Molecular Weight | 488.44 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | 1-ethyl-3-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]-2-(1H-pyrazol-5-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccn[nH]1)NCC1CCCN(C)C1c1cccs1.I |
| InChI | InChI=1S/C18H28N6S.HI/c1-3-19-18(21-13-15-8-9-22-23-15)20-12-14-6-4-10-24(2)17(14)16-7-5-11-25-16;/h5,7-9,11,14,17H,3-4,6,10,12-13H2,1-2H3,(H,22,23)(H2,19,20,21);1H |
| InChIKey | COBNVKAWALPTAJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|