C21H32N4OS2 — CID 109419804
1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]guanidine (PubChem CID 109419804) has the molecular formula C21H32N4OS2 and a molecular weight of 420.65 g/mol. Its IUPAC name is 1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]guanidine.
| Compound Name | 1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109419804 |
| Molecular Formula | C21H32N4OS2 |
| Molecular Weight | 420.65 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]guanidine |
| SMILES | CCN/C(=N\CC(C)(O)c1cccs1)NCC1CCCN(C)C1c1cccs1 |
| InChI | InChI=1S/C21H32N4OS2/c1-4-22-20(24-15-21(2,26)18-10-7-13-28-18)23-14-16-8-5-11-25(3)19(16)17-9-6-12-27-17/h6-7,9-10,12-13,16,19,26H,4-5,8,11,14-15H2,1-3H3,(H2,22,23,24) |
| InChIKey | ZUZKIWWHNCDLLT-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.65 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|