C22H31FN4OS — CID 111987185
1-ethyl-2-[2-(2-fluorophenyl)-2-hydroxyethyl]-3-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]guanidine (PubChem CID 111987185) has the molecular formula C22H31FN4OS and a molecular weight of 418.58 g/mol. Its IUPAC name is 1-ethyl-2-[2-(2-fluorophenyl)-2-hydroxyethyl]-3-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]guanidine.
| Compound Name | 1-ethyl-2-[2-(2-fluorophenyl)-2-hydroxyethyl]-3-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111987185 |
| Molecular Formula | C22H31FN4OS |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | 1-ethyl-2-[2-(2-fluorophenyl)-2-hydroxyethyl]-3-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]guanidine |
| SMILES | CCN/C(=N\CC(O)c1ccccc1F)NCC1CCCN(C)C1c1cccs1 |
| InChI | InChI=1S/C22H31FN4OS/c1-3-24-22(26-15-19(28)17-9-4-5-10-18(17)23)25-14-16-8-6-12-27(2)21(16)20-11-7-13-29-20/h4-5,7,9-11,13,16,19,21,28H,3,6,8,12,14-15H2,1-2H3,(H2,24,25,26) |
| InChIKey | LSQFLOUWWPITKI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|