C17H28N4S — CID 111666042
1-ethyl-2-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]-3-prop-2-enylguanidine (PubChem CID 111666042) has the molecular formula C17H28N4S and a molecular weight of 320.51 g/mol. Its IUPAC name is 1-ethyl-2-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]-3-prop-2-enylguanidine.
| Compound Name | 1-ethyl-2-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]-3-prop-2-enylguanidine |
|---|---|
| PubChem CID | 111666042 |
| Molecular Formula | C17H28N4S |
| Molecular Weight | 320.51 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 1-ethyl-2-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]-3-prop-2-enylguanidine |
| SMILES | C=CCN/C(=N/CC1CCCN(C)C1c1cccs1)NCC |
| InChI | InChI=1S/C17H28N4S/c1-4-10-19-17(18-5-2)20-13-14-8-6-11-21(3)16(14)15-9-7-12-22-15/h4,7,9,12,14,16H,1,5-6,8,10-11,13H2,2-3H3,(H2,18,19,20) |
| InChIKey | MOMDFEIOZLFVIB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.51 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|