C19H32N4S2 — CID 111665996
1-ethyl-2-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]-3-(2-prop-2-enylsulfanylethyl)guanidine (PubChem CID 111665996) has the molecular formula C19H32N4S2 and a molecular weight of 380.63 g/mol. Its IUPAC name is 1-ethyl-2-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]-3-(2-prop-2-enylsulfanylethyl)guanidine.
| Compound Name | 1-ethyl-2-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]-3-(2-prop-2-enylsulfanylethyl)guanidine |
|---|---|
| PubChem CID | 111665996 |
| Molecular Formula | C19H32N4S2 |
| Molecular Weight | 380.63 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 1-ethyl-2-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]-3-(2-prop-2-enylsulfanylethyl)guanidine |
| SMILES | C=CCSCCN/C(=N/CC1CCCN(C)C1c1cccs1)NCC |
| InChI | InChI=1S/C19H32N4S2/c1-4-12-24-14-10-21-19(20-5-2)22-15-16-8-6-11-23(3)18(16)17-9-7-13-25-17/h4,7,9,13,16,18H,1,5-6,8,10-12,14-15H2,2-3H3,(H2,20,21,22) |
| InChIKey | FSERFIVPIDVFBL-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.63 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|