C20H33N5OS — CID 111666058
N-[2-[[N-ethyl-N'-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]carbamimidoyl]amino]ethyl]cyclopropanecarboxamide (PubChem CID 111666058) has the molecular formula C20H33N5OS and a molecular weight of 391.59 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]carbamimidoyl]amino]ethyl]cyclopropanecarboxamide.
| Compound Name | N-[2-[[N-ethyl-N'-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]carbamimidoyl]amino]ethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 111666058 |
| Molecular Formula | C20H33N5OS |
| Molecular Weight | 391.59 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | N-[2-[[N-ethyl-N'-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]carbamimidoyl]amino]ethyl]cyclopropanecarboxamide |
| SMILES | CCN/C(=N\CC1CCCN(C)C1c1cccs1)NCCNC(=O)C1CC1 |
| InChI | InChI=1S/C20H33N5OS/c1-3-21-20(23-11-10-22-19(26)15-8-9-15)24-14-16-6-4-12-25(2)18(16)17-7-5-13-27-17/h5,7,13,15-16,18H,3-4,6,8-12,14H2,1-2H3,(H,22,26)(H2,21,23,24) |
| InChIKey | UYHKOHCAXQOBNF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.59 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|