C22H33IN6OS — CID 111666559
N-[2-[[N-ethyl-N'-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]carbamimidoyl]amino]ethyl]pyridine-3-carboxamide;hydroiodide (PubChem CID 111666559) has the molecular formula C22H33IN6OS and a molecular weight of 556.52 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]carbamimidoyl]amino]ethyl]pyridine-3-carboxamide;hydroiodide.
| Compound Name | N-[2-[[N-ethyl-N'-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]carbamimidoyl]amino]ethyl]pyridine-3-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111666559 |
| Molecular Formula | C22H33IN6OS |
| Molecular Weight | 556.52 g/mol |
| Exact Mass | 556.15 |
| IUPAC Name | N-[2-[[N-ethyl-N'-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]carbamimidoyl]amino]ethyl]pyridine-3-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\CC1CCCN(C)C1c1cccs1)NCCNC(=O)c1cccnc1.I |
| InChI | InChI=1S/C22H32N6OS.HI/c1-3-24-22(26-12-11-25-21(29)18-7-4-10-23-15-18)27-16-17-8-5-13-28(2)20(17)19-9-6-14-30-19;/h4,6-7,9-10,14-15,17,20H,3,5,8,11-13,16H2,1-2H3,(H,25,29)(H2,24,26,27);1H |
| InChIKey | HIFKTROHZBXDAG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.52 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|