C24H36IN5OS — CID 111666453
N-benzyl-3-[[N-ethyl-N'-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]carbamimidoyl]amino]propanamide;hydroiodide (PubChem CID 111666453) has the molecular formula C24H36IN5OS and a molecular weight of 569.56 g/mol. Its IUPAC name is N-benzyl-3-[[N-ethyl-N'-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]carbamimidoyl]amino]propanamide;hydroiodide.
| Compound Name | N-benzyl-3-[[N-ethyl-N'-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]carbamimidoyl]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 111666453 |
| Molecular Formula | C24H36IN5OS |
| Molecular Weight | 569.56 g/mol |
| Exact Mass | 569.17 |
| IUPAC Name | N-benzyl-3-[[N-ethyl-N'-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]carbamimidoyl]amino]propanamide;hydroiodide |
| SMILES | CCN/C(=N\CC1CCCN(C)C1c1cccs1)NCCC(=O)NCc1ccccc1.I |
| InChI | InChI=1S/C24H35N5OS.HI/c1-3-25-24(26-14-13-22(30)27-17-19-9-5-4-6-10-19)28-18-20-11-7-15-29(2)23(20)21-12-8-16-31-21;/h4-6,8-10,12,16,20,23H,3,7,11,13-15,17-18H2,1-2H3,(H,27,30)(H2,25,26,28);1H |
| InChIKey | BHDLOBUDCXBPBS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.56 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|