C24H36N4O2S — CID 109420304
1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-[[2-(4-methoxyphenyl)-1-methylpiperidin-3-yl]methyl]guanidine (PubChem CID 109420304) has the molecular formula C24H36N4O2S and a molecular weight of 444.65 g/mol. Its IUPAC name is 1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-[[2-(4-methoxyphenyl)-1-methylpiperidin-3-yl]methyl]guanidine.
| Compound Name | 1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-[[2-(4-methoxyphenyl)-1-methylpiperidin-3-yl]methyl]guanidine |
|---|---|
| PubChem CID | 109420304 |
| Molecular Formula | C24H36N4O2S |
| Molecular Weight | 444.65 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | 1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-[[2-(4-methoxyphenyl)-1-methylpiperidin-3-yl]methyl]guanidine |
| SMILES | CCN/C(=N\CC(C)(O)c1cccs1)NCC1CCCN(C)C1c1ccc(OC)cc1 |
| InChI | InChI=1S/C24H36N4O2S/c1-5-25-23(27-17-24(2,29)21-9-7-15-31-21)26-16-19-8-6-14-28(3)22(19)18-10-12-20(30-4)13-11-18/h7,9-13,15,19,22,29H,5-6,8,14,16-17H2,1-4H3,(H2,25,26,27) |
| InChIKey | WNKYGJNWYLXJLQ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.65 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|