C21H31N3O3S — CID 111517949
1-ethyl-3-(2-methyl-3-thiophen-2-ylpropyl)-2-[(2,4,5-trimethoxyphenyl)methyl]guanidine (PubChem CID 111517949) has the molecular formula C21H31N3O3S and a molecular weight of 405.56 g/mol. Its IUPAC name is 1-ethyl-3-(2-methyl-3-thiophen-2-ylpropyl)-2-[(2,4,5-trimethoxyphenyl)methyl]guanidine.
| Compound Name | 1-ethyl-3-(2-methyl-3-thiophen-2-ylpropyl)-2-[(2,4,5-trimethoxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111517949 |
| Molecular Formula | C21H31N3O3S |
| Molecular Weight | 405.56 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 1-ethyl-3-(2-methyl-3-thiophen-2-ylpropyl)-2-[(2,4,5-trimethoxyphenyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cc(OC)c(OC)cc1OC)NCC(C)Cc1cccs1 |
| InChI | InChI=1S/C21H31N3O3S/c1-6-22-21(23-13-15(2)10-17-8-7-9-28-17)24-14-16-11-19(26-4)20(27-5)12-18(16)25-3/h7-9,11-12,15H,6,10,13-14H2,1-5H3,(H2,22,23,24) |
| InChIKey | RCNBKQBVFDALSS-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.56 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|