C19H25F2IN4O2 — CID 111192701
2-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-1-ethyl-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide (PubChem CID 111192701) has the molecular formula C19H25F2IN4O2 and a molecular weight of 506.34 g/mol. Its IUPAC name is 2-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-1-ethyl-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-1-ethyl-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111192701 |
| Molecular Formula | C19H25F2IN4O2 |
| Molecular Weight | 506.34 g/mol |
| Exact Mass | 506.10 |
| IUPAC Name | 2-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-1-ethyl-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(OC(F)F)c1)NCCc1ccccn1.I |
| InChI | InChI=1S/C19H24F2N4O2.HI/c1-3-22-19(24-11-9-15-6-4-5-10-23-15)25-13-14-7-8-16(26-2)17(12-14)27-18(20)21;/h4-8,10,12,18H,3,9,11,13H2,1-2H3,(H2,22,24,25);1H |
| InChIKey | BESCREUTIAMEPL-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|