C20H31IN4O3S — CID 111531720
1-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111531720) has the molecular formula C20H31IN4O3S and a molecular weight of 534.46 g/mol. Its IUPAC name is 1-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111531720 |
| Molecular Formula | C20H31IN4O3S |
| Molecular Weight | 534.46 g/mol |
| Exact Mass | 534.12 |
| IUPAC Name | 1-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | CCOc1c(OC)cc(CN/C(=N/C)NCCc2ncc(CC)s2)cc1OC.I |
| InChI | InChI=1S/C20H30N4O3S.HI/c1-6-15-13-23-18(28-15)8-9-22-20(21-3)24-12-14-10-16(25-4)19(27-7-2)17(11-14)26-5;/h10-11,13H,6-9,12H2,1-5H3,(H2,21,22,24);1H |
| InChIKey | MJXBOCWIUHNEKD-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.46 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|