C19H26N4O3S — CID 111531939
methyl 5-[[[N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]-2-methoxybenzoate (PubChem CID 111531939) has the molecular formula C19H26N4O3S and a molecular weight of 390.51 g/mol. Its IUPAC name is methyl 5-[[[N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]-2-methoxybenzoate.
| Compound Name | methyl 5-[[[N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]-2-methoxybenzoate |
|---|---|
| PubChem CID | 111531939 |
| Molecular Formula | C19H26N4O3S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | methyl 5-[[[N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]-2-methoxybenzoate |
| SMILES | CCc1cnc(CCN/C(=N\C)NCc2ccc(OC)c(C(=O)OC)c2)s1 |
| InChI | InChI=1S/C19H26N4O3S/c1-5-14-12-22-17(27-14)8-9-21-19(20-2)23-11-13-6-7-16(25-3)15(10-13)18(24)26-4/h6-7,10,12H,5,8-9,11H2,1-4H3,(H2,20,21,23) |
| InChIKey | NRTYXPFMPHFQNF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|