C19H25IN4O3 — CID 111193715
methyl 2-methoxy-5-[[[N'-methyl-N-(2-pyridin-2-ylethyl)carbamimidoyl]amino]methyl]benzoate;hydroiodide (PubChem CID 111193715) has the molecular formula C19H25IN4O3 and a molecular weight of 484.34 g/mol. Its IUPAC name is methyl 2-methoxy-5-[[[N'-methyl-N-(2-pyridin-2-ylethyl)carbamimidoyl]amino]methyl]benzoate;hydroiodide.
| Compound Name | methyl 2-methoxy-5-[[[N'-methyl-N-(2-pyridin-2-ylethyl)carbamimidoyl]amino]methyl]benzoate;hydroiodide |
|---|---|
| PubChem CID | 111193715 |
| Molecular Formula | C19H25IN4O3 |
| Molecular Weight | 484.34 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | methyl 2-methoxy-5-[[[N'-methyl-N-(2-pyridin-2-ylethyl)carbamimidoyl]amino]methyl]benzoate;hydroiodide |
| SMILES | C/N=C(\NCCc1ccccn1)NCc1ccc(OC)c(C(=O)OC)c1.I |
| InChI | InChI=1S/C19H24N4O3.HI/c1-20-19(22-11-9-15-6-4-5-10-21-15)23-13-14-7-8-17(25-2)16(12-14)18(24)26-3;/h4-8,10,12H,9,11,13H2,1-3H3,(H2,20,22,23);1H |
| InChIKey | AFUILBMYNRYUIM-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|