C19H25F3N4O3S — CID 111689018
1-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine (PubChem CID 111689018) has the molecular formula C19H25F3N4O3S and a molecular weight of 446.50 g/mol. Its IUPAC name is 1-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine.
| Compound Name | 1-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 111689018 |
| Molecular Formula | C19H25F3N4O3S |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 1-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine |
| SMILES | CCOc1c(OC)cc(CN/C(=N/C)NCCc2nc(C(F)(F)F)cs2)cc1OC |
| InChI | InChI=1S/C19H25F3N4O3S/c1-5-29-17-13(27-3)8-12(9-14(17)28-4)10-25-18(23-2)24-7-6-16-26-15(11-30-16)19(20,21)22/h8-9,11H,5-7,10H2,1-4H3,(H2,23,24,25) |
| InChIKey | YTSJXNSNWWLHJO-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|