C19H26F3IN4O2S — CID 111688207
2-[(4-ethoxy-3-methoxyphenyl)methyl]-1-ethyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide (PubChem CID 111688207) has the molecular formula C19H26F3IN4O2S and a molecular weight of 558.41 g/mol. Its IUPAC name is 2-[(4-ethoxy-3-methoxyphenyl)methyl]-1-ethyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide.
| Compound Name | 2-[(4-ethoxy-3-methoxyphenyl)methyl]-1-ethyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111688207 |
| Molecular Formula | C19H26F3IN4O2S |
| Molecular Weight | 558.41 g/mol |
| Exact Mass | 558.08 |
| IUPAC Name | 2-[(4-ethoxy-3-methoxyphenyl)methyl]-1-ethyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OCC)c(OC)c1)NCCc1nc(C(F)(F)F)cs1.I |
| InChI | InChI=1S/C19H25F3N4O2S.HI/c1-4-23-18(24-9-8-17-26-16(12-29-17)19(20,21)22)25-11-13-6-7-14(28-5-2)15(10-13)27-3;/h6-7,10,12H,4-5,8-9,11H2,1-3H3,(H2,23,24,25);1H |
| InChIKey | NJRWRSXQBXCDFR-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.41 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|