C19H26F3IN4O3S — CID 111988430
2-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-1-ethyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide (PubChem CID 111988430) has the molecular formula C19H26F3IN4O3S and a molecular weight of 574.41 g/mol. Its IUPAC name is 2-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-1-ethyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide.
| Compound Name | 2-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-1-ethyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111988430 |
| Molecular Formula | C19H26F3IN4O3S |
| Molecular Weight | 574.41 g/mol |
| Exact Mass | 574.07 |
| IUPAC Name | 2-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-1-ethyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1cc(OC)ccc1OC)NCCc1nc(C(F)(F)F)cs1.I |
| InChI | InChI=1S/C19H25F3N4O3S.HI/c1-4-23-18(24-8-7-17-26-16(11-30-17)19(20,21)22)25-10-14(27)13-9-12(28-2)5-6-15(13)29-3;/h5-6,9,11,14,27H,4,7-8,10H2,1-3H3,(H2,23,24,25);1H |
| InChIKey | RIJXJNNFDFUADE-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|