C18H24F3IN4O2S — CID 111615011
1-[2-(2,5-dimethoxyphenyl)ethyl]-3-ethyl-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide (PubChem CID 111615011) has the molecular formula C18H24F3IN4O2S and a molecular weight of 544.38 g/mol. Its IUPAC name is 1-[2-(2,5-dimethoxyphenyl)ethyl]-3-ethyl-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(2,5-dimethoxyphenyl)ethyl]-3-ethyl-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111615011 |
| Molecular Formula | C18H24F3IN4O2S |
| Molecular Weight | 544.38 g/mol |
| Exact Mass | 544.06 |
| IUPAC Name | 1-[2-(2,5-dimethoxyphenyl)ethyl]-3-ethyl-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nc(C(F)(F)F)cs1)NCCc1cc(OC)ccc1OC.I |
| InChI | InChI=1S/C18H23F3N4O2S.HI/c1-4-22-17(24-10-16-25-15(11-28-16)18(19,20)21)23-8-7-12-9-13(26-2)5-6-14(12)27-3;/h5-6,9,11H,4,7-8,10H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | WXLDECJRMPDRHS-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|