C18H23F3IN5O2S — CID 111617698
N-[2-[[N-ethyl-N'-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]ethyl]-3-methoxybenzamide;hydroiodide (PubChem CID 111617698) has the molecular formula C18H23F3IN5O2S and a molecular weight of 557.38 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]ethyl]-3-methoxybenzamide;hydroiodide.
| Compound Name | N-[2-[[N-ethyl-N'-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]ethyl]-3-methoxybenzamide;hydroiodide |
|---|---|
| PubChem CID | 111617698 |
| Molecular Formula | C18H23F3IN5O2S |
| Molecular Weight | 557.38 g/mol |
| Exact Mass | 557.06 |
| IUPAC Name | N-[2-[[N-ethyl-N'-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]ethyl]-3-methoxybenzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1nc(C(F)(F)F)cs1)NCCNC(=O)c1cccc(OC)c1.I |
| InChI | InChI=1S/C18H22F3N5O2S.HI/c1-3-22-17(25-10-15-26-14(11-29-15)18(19,20)21)24-8-7-23-16(27)12-5-4-6-13(9-12)28-2;/h4-6,9,11H,3,7-8,10H2,1-2H3,(H,23,27)(H2,22,24,25);1H |
| InChIKey | CJNMWQMMWWKZCN-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 87.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.38 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|