C20H27F3N4O2S — CID 111689982
1-ethyl-2-[(3-methoxy-4-propoxyphenyl)methyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine (PubChem CID 111689982) has the molecular formula C20H27F3N4O2S and a molecular weight of 444.52 g/mol. Its IUPAC name is 1-ethyl-2-[(3-methoxy-4-propoxyphenyl)methyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine.
| Compound Name | 1-ethyl-2-[(3-methoxy-4-propoxyphenyl)methyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 111689982 |
| Molecular Formula | C20H27F3N4O2S |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 1-ethyl-2-[(3-methoxy-4-propoxyphenyl)methyl]-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine |
| SMILES | CCCOc1ccc(C/N=C(\NCC)NCCc2nc(C(F)(F)F)cs2)cc1OC |
| InChI | InChI=1S/C20H27F3N4O2S/c1-4-10-29-15-7-6-14(11-16(15)28-3)12-26-19(24-5-2)25-9-8-18-27-17(13-30-18)20(21,22)23/h6-7,11,13H,4-5,8-10,12H2,1-3H3,(H2,24,25,26) |
| InChIKey | PWYOMNCQUSCTAN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|