C20H29F3IN5OS — CID 111687857
2-[[3-[2-(dimethylamino)ethoxy]phenyl]methyl]-1-ethyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide (PubChem CID 111687857) has the molecular formula C20H29F3IN5OS and a molecular weight of 571.45 g/mol. Its IUPAC name is 2-[[3-[2-(dimethylamino)ethoxy]phenyl]methyl]-1-ethyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide.
| Compound Name | 2-[[3-[2-(dimethylamino)ethoxy]phenyl]methyl]-1-ethyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111687857 |
| Molecular Formula | C20H29F3IN5OS |
| Molecular Weight | 571.45 g/mol |
| Exact Mass | 571.11 |
| IUPAC Name | 2-[[3-[2-(dimethylamino)ethoxy]phenyl]methyl]-1-ethyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(OCCN(C)C)c1)NCCc1nc(C(F)(F)F)cs1.I |
| InChI | InChI=1S/C20H28F3N5OS.HI/c1-4-24-19(25-9-8-18-27-17(14-30-18)20(21,22)23)26-13-15-6-5-7-16(12-15)29-11-10-28(2)3;/h5-7,12,14H,4,8-11,13H2,1-3H3,(H2,24,25,26);1H |
| InChIKey | MQMODXONGCTWOG-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.45 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|