C19H24F2IN3O3 — CID 111324307
1-[1-(3,4-difluorophenyl)ethyl]-3-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111324307) has the molecular formula C19H24F2IN3O3 and a molecular weight of 507.32 g/mol. Its IUPAC name is 1-[1-(3,4-difluorophenyl)ethyl]-3-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[1-(3,4-difluorophenyl)ethyl]-3-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111324307 |
| Molecular Formula | C19H24F2IN3O3 |
| Molecular Weight | 507.32 g/mol |
| Exact Mass | 507.08 |
| IUPAC Name | 1-[1-(3,4-difluorophenyl)ethyl]-3-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cc(OC)c(O)c(OC)c1)NC(C)c1ccc(F)c(F)c1.I |
| InChI | InChI=1S/C19H23F2N3O3.HI/c1-11(13-5-6-14(20)15(21)9-13)24-19(22-2)23-10-12-7-16(26-3)18(25)17(8-12)27-4;/h5-9,11,25H,10H2,1-4H3,(H2,22,23,24);1H |
| InChIKey | XCTBEKLTYDMULC-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.32 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|